C22H26N4O2 — CID 123444073
tert-butyl 3-[(4-amino-2-methyl-2,3-dihydroindol-1-yl)methyl]pyrrolo[2,3-b]pyridine-1-carboxylate (PubChem CID 123444073) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is tert-butyl 3-[(4-amino-2-methyl-2,3-dihydroindol-1-yl)methyl]pyrrolo[2,3-b]pyridine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-amino-2-methyl-2,3-dihydroindol-1-yl)methyl]pyrrolo[2,3-b]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 123444073 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | tert-butyl 3-[(4-amino-2-methyl-2,3-dihydroindol-1-yl)methyl]pyrrolo[2,3-b]pyridine-1-carboxylate |
| SMILES | CC1Cc2c(N)cccc2N1Cc1cn(C(=O)OC(C)(C)C)c2ncccc12 |
| InChI | InChI=1S/C22H26N4O2/c1-14-11-17-18(23)8-5-9-19(17)25(14)12-15-13-26(21(27)28-22(2,3)4)20-16(15)7-6-10-24-20/h5-10,13-14H,11-12,23H2,1-4H3 |
| InChIKey | FJTORNFOQBJHNL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|