C35H25N3O4 — CID 11734329
13-methyl-5,21-bis(phenylmethoxy)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione (PubChem CID 11734329) has the molecular formula C35H25N3O4 and a molecular weight of 551.60 g/mol. Its IUPAC name is 13-methyl-5,21-bis(phenylmethoxy)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione.
| Compound Name | 13-methyl-5,21-bis(phenylmethoxy)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
|---|---|
| PubChem CID | 11734329 |
| Molecular Formula | C35H25N3O4 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 13-methyl-5,21-bis(phenylmethoxy)-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-12,14-dione |
| SMILES | CN1C(=O)c2c(c3c4cccc(OCc5ccccc5)c4[nH]c3c3[nH]c4c(OCc5ccccc5)cccc4c23)C1=O |
| InChI | InChI=1S/C35H25N3O4/c1-38-34(39)28-26-22-14-8-16-24(41-18-20-10-4-2-5-11-20)30(22)36-32(26)33-27(29(28)35(38)40)23-15-9-17-25(31(23)37-33)42-19-21-12-6-3-7-13-21/h2-17,36-37H,18-19H2,1H3 |
| InChIKey | FQCBRGQMUAEKSS-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 87.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|