C20H21NO3 — CID 142244182
ethane;5-(oxiran-2-yl)-8-phenylmethoxy-1H-quinolin-2-one (PubChem CID 142244182) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is ethane;5-(oxiran-2-yl)-8-phenylmethoxy-1H-quinolin-2-one.
| Compound Name | ethane;5-(oxiran-2-yl)-8-phenylmethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 142244182 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | ethane;5-(oxiran-2-yl)-8-phenylmethoxy-1H-quinolin-2-one |
| SMILES | CC.O=c1ccc2c(C3CO3)ccc(OCc3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C18H15NO3.C2H6/c20-17-9-7-14-13(16-11-22-16)6-8-15(18(14)19-17)21-10-12-4-2-1-3-5-12;1-2/h1-9,16H,10-11H2,(H,19,20);1-2H3 |
| InChIKey | YECRXZCZTRYNJG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|