C32H35N2O3+ — CID 70998527
(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)-[(2R)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]-methylideneazanium (PubChem CID 70998527) has the molecular formula C32H35N2O3+ and a molecular weight of 495.64 g/mol. Its IUPAC name is (5,6-diethyl-2,3-dihydro-1H-inden-2-yl)-[(2R)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]-methylideneazanium.
| Compound Name | (5,6-diethyl-2,3-dihydro-1H-inden-2-yl)-[(2R)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]-methylideneazanium |
|---|---|
| PubChem CID | 70998527 |
| Molecular Formula | C32H35N2O3+ |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | (5,6-diethyl-2,3-dihydro-1H-inden-2-yl)-[(2R)-2-hydroxy-2-(2-oxo-8-phenylmethoxy-1H-quinolin-5-yl)ethyl]-methylideneazanium |
| SMILES | C=[N+](C[C@H](O)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12)C1Cc2cc(CC)c(CC)cc2C1 |
| InChI | InChI=1S/C32H34N2O3/c1-4-22-15-24-17-26(18-25(24)16-23(22)5-2)34(3)19-29(35)27-11-13-30(32-28(27)12-14-31(36)33-32)37-20-21-9-7-6-8-10-21/h6-16,26,29,35H,3-5,17-20H2,1-2H3/p+1/t29-/m0/s1 |
| InChIKey | YXLRWYKBLFPHBE-LJAQVGFWSA-O |
| XLogP | 5.15 |
| TPSA | 65.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|