C33H36N2O7 — CID 175345091
5-[2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one;oxalic acid (PubChem CID 175345091) has the molecular formula C33H36N2O7 and a molecular weight of 572.66 g/mol. Its IUPAC name is 5-[2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one;oxalic acid.
| Compound Name | 5-[2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one;oxalic acid |
|---|---|
| PubChem CID | 175345091 |
| Molecular Formula | C33H36N2O7 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 5-[2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one;oxalic acid |
| SMILES | CCc1cc2c(cc1CC)CC(NCC(O)c1ccc(OCc3ccccc3)c3[nH]c(=O)ccc13)C2.O=C(O)C(=O)O |
| InChI | InChI=1S/C31H34N2O3.C2H2O4/c1-3-21-14-23-16-25(17-24(23)15-22(21)4-2)32-18-28(34)26-10-12-29(31-27(26)11-13-30(35)33-31)36-19-20-8-6-5-7-9-20;3-1(4)2(5)6/h5-15,25,28,32,34H,3-4,16-19H2,1-2H3,(H,33,35);(H,3,4)(H,5,6) |
| InChIKey | ZVOGVASFRJBFNW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|