C33H32N2O7 — CID 141486494
6-[(1R)-2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-3-phenylmethoxy-10,13-dioxa-1-azatricyclo[7.4.1.02,7]tetradeca-2,4,6,8-tetraene-11,12,14-trione (PubChem CID 141486494) has the molecular formula C33H32N2O7 and a molecular weight of 568.63 g/mol. Its IUPAC name is 6-[(1R)-2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-3-phenylmethoxy-10,13-dioxa-1-azatricyclo[7.4.1.02,7]tetradeca-2,4,6,8-tetraene-11,12,14-trione.
| Compound Name | 6-[(1R)-2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-3-phenylmethoxy-10,13-dioxa-1-azatricyclo[7.4.1.02,7]tetradeca-2,4,6,8-tetraene-11,12,14-trione |
|---|---|
| PubChem CID | 141486494 |
| Molecular Formula | C33H32N2O7 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.22 |
| IUPAC Name | 6-[(1R)-2-[(5,6-diethyl-2,3-dihydro-1H-inden-2-yl)amino]-1-hydroxyethyl]-3-phenylmethoxy-10,13-dioxa-1-azatricyclo[7.4.1.02,7]tetradeca-2,4,6,8-tetraene-11,12,14-trione |
| SMILES | CCc1cc2c(cc1CC)CC(NC[C@H](O)c1ccc(OCc3ccccc3)c3c1cc1c(=O)n3OC(=O)C(=O)O1)C2 |
| InChI | InChI=1S/C33H32N2O7/c1-3-20-12-22-14-24(15-23(22)13-21(20)4-2)34-17-27(36)25-10-11-28(40-18-19-8-6-5-7-9-19)30-26(25)16-29-31(37)35(30)42-33(39)32(38)41-29/h5-13,16,24,27,34,36H,3-4,14-15,17-18H2,1-2H3/t27-/m0/s1 |
| InChIKey | NLOXZUAFAJKXOE-MHZLTWQESA-N |
| XLogP | 3.37 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|