C22H24N2O — CID 53253143
(1S,12R)-16-methyl-7-phenylmethoxy-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene (PubChem CID 53253143) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is (1S,12R)-16-methyl-7-phenylmethoxy-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene.
| Compound Name | (1S,12R)-16-methyl-7-phenylmethoxy-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 53253143 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (1S,12R)-16-methyl-7-phenylmethoxy-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene |
| SMILES | CN1[C@@H]2CCC[C@H]1c1c([nH]c3c(OCc4ccccc4)cccc13)C2 |
| InChI | InChI=1S/C22H24N2O/c1-24-16-9-5-11-19(24)21-17-10-6-12-20(22(17)23-18(21)13-16)25-14-15-7-3-2-4-8-15/h2-4,6-8,10,12,16,19,23H,5,9,11,13-14H2,1H3/t16-,19+/m1/s1 |
| InChIKey | LFTFWMBEJLCJHC-APWZRJJASA-N |
| XLogP | 4.83 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|