C21H22N2O — CID 53253184
(1S,12R)-7-phenylmethoxy-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene (PubChem CID 53253184) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is (1S,12R)-7-phenylmethoxy-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene.
| Compound Name | (1S,12R)-7-phenylmethoxy-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene |
|---|---|
| PubChem CID | 53253184 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (1S,12R)-7-phenylmethoxy-9,16-diazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraene |
| SMILES | c1ccc(COc2cccc3c4c([nH]c23)C[C@H]2CCC[C@@H]4N2)cc1 |
| InChI | InChI=1S/C21H22N2O/c1-2-6-14(7-3-1)13-24-19-11-5-9-16-20-17-10-4-8-15(22-17)12-18(20)23-21(16)19/h1-3,5-7,9,11,15,17,22-23H,4,8,10,12-13H2/t15-,17+/m1/s1 |
| InChIKey | YYENZXGMHPZKHE-WBVHZDCISA-N |
| XLogP | 4.49 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|