C35H34N2O5 — CID 166446080
1-O-tert-butyl 2-O-methyl 3-(benzhydrylideneamino)-5-phenylmethoxy-2,3-dihydroindole-1,2-dicarboxylate (PubChem CID 166446080) has the molecular formula C35H34N2O5 and a molecular weight of 562.67 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl 3-(benzhydrylideneamino)-5-phenylmethoxy-2,3-dihydroindole-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl 3-(benzhydrylideneamino)-5-phenylmethoxy-2,3-dihydroindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 166446080 |
| Molecular Formula | C35H34N2O5 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl 3-(benzhydrylideneamino)-5-phenylmethoxy-2,3-dihydroindole-1,2-dicarboxylate |
| SMILES | COC(=O)C1C(N=C(c2ccccc2)c2ccccc2)c2cc(OCc3ccccc3)ccc2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H34N2O5/c1-35(2,3)42-34(39)37-29-21-20-27(41-23-24-14-8-5-9-15-24)22-28(29)31(32(37)33(38)40-4)36-30(25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-22,31-32H,23H2,1-4H3 |
| InChIKey | WANVXTMCBJCGJH-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|