C22H12N2O4 — CID 68897410
5-(5-oxochrysen-6-ylidene)-1,3-diazinane-2,4,6-trione (PubChem CID 68897410) has the molecular formula C22H12N2O4 and a molecular weight of 368.35 g/mol. Its IUPAC name is 5-(5-oxochrysen-6-ylidene)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(5-oxochrysen-6-ylidene)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 68897410 |
| Molecular Formula | C22H12N2O4 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 5-(5-oxochrysen-6-ylidene)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=C2C(=O)c3c(ccc4ccccc34)-c3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C22H12N2O4/c25-19-16-12-6-2-1-5-11(12)9-10-15(16)13-7-3-4-8-14(13)17(19)18-20(26)23-22(28)24-21(18)27/h1-10H,(H2,23,24,26,27,28) |
| InChIKey | FZRHZDVVSRMNJU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|