C9H6N2O2 — CID 90904484
8-iminoquinoline-5,6-dione (PubChem CID 90904484) has the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. Its IUPAC name is 8-iminoquinoline-5,6-dione.
| Compound Name | 8-iminoquinoline-5,6-dione |
|---|---|
| PubChem CID | 90904484 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 8-iminoquinoline-5,6-dione |
| SMILES | [H]/N=C1\CC(=O)C(=O)c2cccnc21 |
| InChI | InChI=1S/C9H6N2O2/c10-6-4-7(12)9(13)5-2-1-3-11-8(5)6/h1-3,10H,4H2/b10-6+ |
| InChIKey | SEXHJNWPZFCMFF-UXBLZVDNSA-N |
| XLogP | 0.60 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|