C10H8N2O — CID 57313844
3,4-diiminonaphthalen-1-one (PubChem CID 57313844) has the molecular formula C10H8N2O and a molecular weight of 172.19 g/mol. Its IUPAC name is 3,4-diiminonaphthalen-1-one.
| Compound Name | 3,4-diiminonaphthalen-1-one |
|---|---|
| PubChem CID | 57313844 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 3,4-diiminonaphthalen-1-one |
| SMILES | [H]/N=C1C(=N\[H])\CC(=O)c2ccccc2\1 |
| InChI | InChI=1S/C10H8N2O/c11-8-5-9(13)6-3-1-2-4-7(6)10(8)12/h1-4,11-12H,5H2/b11-8+,12-10- |
| InChIKey | LXFOVARHWJSBLX-GWPDKMJPSA-N |
| XLogP | 1.66 |
| TPSA | 64.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|