About anthracene-9,10-diimine
anthracene-9,10-diimine (PubChem CID 22601866) has the molecular formula C14H10N2
and a molecular weight of 206.25 g/mol. Its IUPAC name is anthracene-9,10-diimine.
Molecular Properties
| Compound Name | anthracene-9,10-diimine |
| PubChem CID | 22601866 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | anthracene-9,10-diimine |
| SMILES | [H]N=C1c2ccccc2C(=N[H])c2ccccc21 |
| InChI | InChI=1S/C14H10N2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8,15-16H/b15-13-,16-14+ |
| InChIKey | BJTZWEABCKXEJD-VCFJNTAESA-N |
| XLogP | 2.83 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze anthracene-9,10-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-9,10-diimine?
The IUPAC name of anthracene-9,10-diimine (CID 22601866) is anthracene-9,10-diimine.
What is the SMILES notation for anthracene-9,10-diimine?
The canonical SMILES for anthracene-9,10-diimine is [H]N=C1c2ccccc2C(=N[H])c2ccccc21.
What is the InChIKey of anthracene-9,10-diimine?
The InChIKey is BJTZWEABCKXEJD-VCFJNTAESA-N. The full InChI is InChI=1S/C14H10N2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-8,15-16H/b15-13-,16-14+.
What are the key properties of anthracene-9,10-diimine?
anthracene-9,10-diimine has a molecular weight of 206.25 g/mol, XLogP of 2.83, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9,10-diimine is sourced from PubChem (CID 22601866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).