C9H6N2O3 — CID 173421671
1-nitrosoquinoline-2,4-dione (PubChem CID 173421671) has the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. Its IUPAC name is 1-nitrosoquinoline-2,4-dione.
| Compound Name | 1-nitrosoquinoline-2,4-dione |
|---|---|
| PubChem CID | 173421671 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 1-nitrosoquinoline-2,4-dione |
| SMILES | O=NN1C(=O)CC(=O)c2ccccc21 |
| InChI | InChI=1S/C9H6N2O3/c12-8-5-9(13)11(10-14)7-4-2-1-3-6(7)8/h1-4H,5H2 |
| InChIKey | GTSXYUGUTVOUOT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|