C9H6N2O4 — CID 172714245
1-nitroquinoline-2,4-dione (PubChem CID 172714245) has the molecular formula C9H6N2O4 and a molecular weight of 206.16 g/mol. Its IUPAC name is 1-nitroquinoline-2,4-dione.
| Compound Name | 1-nitroquinoline-2,4-dione |
|---|---|
| PubChem CID | 172714245 |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 1-nitroquinoline-2,4-dione |
| SMILES | O=C1CC(=O)N([N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C9H6N2O4/c12-8-5-9(13)10(11(14)15)7-4-2-1-3-6(7)8/h1-4H,5H2 |
| InChIKey | FQPBJPPSXBYNSB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|