C11H10N2O3 — CID 140882905
1'-nitrospiro[cyclobutane-1,3'-indole]-2'-one (PubChem CID 140882905) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 1'-nitrospiro[cyclobutane-1,3'-indole]-2'-one.
| Compound Name | 1'-nitrospiro[cyclobutane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 140882905 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 1'-nitrospiro[cyclobutane-1,3'-indole]-2'-one |
| SMILES | O=C1N([N+](=O)[O-])c2ccccc2C12CCC2 |
| InChI | InChI=1S/C11H10N2O3/c14-10-11(6-3-7-11)8-4-1-2-5-9(8)12(10)13(15)16/h1-2,4-5H,3,6-7H2 |
| InChIKey | RBSNDOHUFGCQNK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|