C13H11NO4 — CID 10988540
3,10-dioxa-13-azabicyclo[10.4.0]hexadeca-1(12),13,15-trien-6-yne-2,11-dione (PubChem CID 10988540) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is 3,10-dioxa-13-azabicyclo[10.4.0]hexadeca-1(12),13,15-trien-6-yne-2,11-dione.
| Compound Name | 3,10-dioxa-13-azabicyclo[10.4.0]hexadeca-1(12),13,15-trien-6-yne-2,11-dione |
|---|---|
| PubChem CID | 10988540 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3,10-dioxa-13-azabicyclo[10.4.0]hexadeca-1(12),13,15-trien-6-yne-2,11-dione |
| SMILES | O=C1OCCC#CCCOC(=O)c2ncccc21 |
| InChI | InChI=1S/C13H11NO4/c15-12-10-6-5-7-14-11(10)13(16)18-9-4-2-1-3-8-17-12/h5-7H,3-4,8-9H2 |
| InChIKey | VUAZJTFRNZAPGL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|