About 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one
1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one (PubChem CID 135067369) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one.
Molecular Properties
| Compound Name | 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one |
| PubChem CID | 135067369 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one |
| SMILES | CN1CCOC(=O)c2cccnc21 |
| InChI | InChI=1S/C9H10N2O2/c1-11-5-6-13-9(12)7-3-2-4-10-8(7)11/h2-4H,5-6H2,1H3 |
| InChIKey | ALTUOCOYBQKTAI-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one?
The IUPAC name of 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one (CID 135067369) is 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one.
What is the SMILES notation for 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one?
The canonical SMILES for 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one is CN1CCOC(=O)c2cccnc21.
What is the InChIKey of 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one?
The InChIKey is ALTUOCOYBQKTAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-11-5-6-13-9(12)7-3-2-4-10-8(7)11/h2-4H,5-6H2,1H3.
What are the key properties of 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one?
1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one has a molecular weight of 178.19 g/mol, XLogP of 0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,3-dihydropyrido[2,3-e][1,4]oxazepin-5-one is sourced from PubChem (CID 135067369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).