C10H10N2O — CID 76847801
(3Z)-3-ethylidene-1-methylpyrrolo[2,3-b]pyridin-2-one (PubChem CID 76847801) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is (3Z)-3-ethylidene-1-methylpyrrolo[2,3-b]pyridin-2-one.
| Compound Name | (3Z)-3-ethylidene-1-methylpyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 76847801 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (3Z)-3-ethylidene-1-methylpyrrolo[2,3-b]pyridin-2-one |
| SMILES | C/C=C1\C(=O)N(C)c2ncccc21 |
| InChI | InChI=1S/C10H10N2O/c1-3-7-8-5-4-6-11-9(8)12(2)10(7)13/h3-6H,1-2H3/b7-3- |
| InChIKey | IXPJLHOEJJOFPU-CLTKARDFSA-N |
| XLogP | 1.46 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|