About 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one
6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one (PubChem CID 21300282) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one.
Molecular Properties
| Compound Name | 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one |
| PubChem CID | 21300282 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one |
| SMILES | CN1C(=O)c2cccnc2C1(C)C |
| InChI | InChI=1S/C10H12N2O/c1-10(2)8-7(5-4-6-11-8)9(13)12(10)3/h4-6H,1-3H3 |
| InChIKey | DSYIAVYZKRMOJA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one?
The IUPAC name of 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one (CID 21300282) is 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one.
What is the SMILES notation for 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one?
The canonical SMILES for 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one is CN1C(=O)c2cccnc2C1(C)C.
What is the InChIKey of 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one?
The InChIKey is DSYIAVYZKRMOJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-10(2)8-7(5-4-6-11-8)9(13)12(10)3/h4-6H,1-3H3.
What are the key properties of 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one?
6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one has a molecular weight of 176.22 g/mol, XLogP of 1.40, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7,7-trimethylpyrrolo[3,4-b]pyridin-5-one is sourced from PubChem (CID 21300282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).