About CID 14338055
CID 14338055 (PubChem CID 14338055) has the molecular formula C15H11NO2
and a molecular weight of 237.26 g/mol.
Molecular Properties
| Compound Name | CID 14338055 |
| PubChem CID | 14338055 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | — |
| SMILES | c1ccc2c(c1)C1(CO1)c1cccnc1C21CO1 |
| InChI | InChI=1S/C15H11NO2/c1-2-5-11-10(4-1)14(8-17-14)12-6-3-7-16-13(12)15(11)9-18-15/h1-7H,8-9H2 |
| InChIKey | HDMKDOBQOLNDQE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 37.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 14338055 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 14338055?
The IUPAC name of CID 14338055 (CID 14338055) is not available.
What is the SMILES notation for CID 14338055?
The canonical SMILES for CID 14338055 is c1ccc2c(c1)C1(CO1)c1cccnc1C21CO1.
What is the InChIKey of CID 14338055?
The InChIKey is HDMKDOBQOLNDQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO2/c1-2-5-11-10(4-1)14(8-17-14)12-6-3-7-16-13(12)15(11)9-18-15/h1-7H,8-9H2.
What are the key properties of CID 14338055?
CID 14338055 has a molecular weight of 237.26 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 14338055 is sourced from PubChem (CID 14338055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).