C13H16N2O3 — CID 157036942
7-[(E)-2-morpholin-4-ylethenyl]-5H-furo[3,4-b]pyridin-7-ol (PubChem CID 157036942) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 7-[(E)-2-morpholin-4-ylethenyl]-5H-furo[3,4-b]pyridin-7-ol.
| Compound Name | 7-[(E)-2-morpholin-4-ylethenyl]-5H-furo[3,4-b]pyridin-7-ol |
|---|---|
| PubChem CID | 157036942 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 7-[(E)-2-morpholin-4-ylethenyl]-5H-furo[3,4-b]pyridin-7-ol |
| SMILES | OC1(/C=C/N2CCOCC2)OCc2cccnc21 |
| InChI | InChI=1S/C13H16N2O3/c16-13(3-5-15-6-8-17-9-7-15)12-11(10-18-13)2-1-4-14-12/h1-5,16H,6-10H2/b5-3+ |
| InChIKey | VIACWYDHAOHGHR-HWKANZROSA-N |
| XLogP | 0.60 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |