C16H17N3O — CID 175717906
1'-pyridin-2-ylspiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] (PubChem CID 175717906) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 1'-pyridin-2-ylspiro[5H-furo[3,4-b]pyridine-7,4'-piperidine].
| Compound Name | 1'-pyridin-2-ylspiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] |
|---|---|
| PubChem CID | 175717906 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1'-pyridin-2-ylspiro[5H-furo[3,4-b]pyridine-7,4'-piperidine] |
| SMILES | c1ccc(N2CCC3(CC2)OCc2cccnc23)nc1 |
| InChI | InChI=1S/C16H17N3O/c1-2-8-17-14(5-1)19-10-6-16(7-11-19)15-13(12-20-16)4-3-9-18-15/h1-5,8-9H,6-7,10-12H2 |
| InChIKey | ALSIVVKEJMFSNH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |