C12H16N2O — CID 90842756
1'-methylspiro[7H-furo[3,4-b]pyridine-5,4'-piperidine] (PubChem CID 90842756) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1'-methylspiro[7H-furo[3,4-b]pyridine-5,4'-piperidine].
| Compound Name | 1'-methylspiro[7H-furo[3,4-b]pyridine-5,4'-piperidine] |
|---|---|
| PubChem CID | 90842756 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1'-methylspiro[7H-furo[3,4-b]pyridine-5,4'-piperidine] |
| SMILES | CN1CCC2(CC1)OCc1ncccc12 |
| InChI | InChI=1S/C12H16N2O/c1-14-7-4-12(5-8-14)10-3-2-6-13-11(10)9-15-12/h2-3,6H,4-5,7-9H2,1H3 |
| InChIKey | BJWLACHDBTTZJS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |