C10H11N2O2- — CID 87227698
1'-oxidospiro[7H-furo[3,4-b]pyridine-5,3'-pyrrolidine] (PubChem CID 87227698) has the molecular formula C10H11N2O2- and a molecular weight of 191.21 g/mol. Its IUPAC name is 1'-oxidospiro[7H-furo[3,4-b]pyridine-5,3'-pyrrolidine].
| Compound Name | 1'-oxidospiro[7H-furo[3,4-b]pyridine-5,3'-pyrrolidine] |
|---|---|
| PubChem CID | 87227698 |
| Molecular Formula | C10H11N2O2- |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 1'-oxidospiro[7H-furo[3,4-b]pyridine-5,3'-pyrrolidine] |
| SMILES | [O-]N1CCC2(C1)OCc1ncccc12 |
| InChI | InChI=1S/C10H11N2O2/c13-12-5-3-10(7-12)8-2-1-4-11-9(8)6-14-10/h1-2,4H,3,5-7H2/q-1 |
| InChIKey | DUSGIJRMWNSFRV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |