C18H27ClN2O4 — CID 169305639
2-[3-(2-chlorospiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane]-4-yl)oxypropoxy]-N,N-dimethylethanamine (PubChem CID 169305639) has the molecular formula C18H27ClN2O4 and a molecular weight of 370.88 g/mol. Its IUPAC name is 2-[3-(2-chlorospiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane]-4-yl)oxypropoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[3-(2-chlorospiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane]-4-yl)oxypropoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 169305639 |
| Molecular Formula | C18H27ClN2O4 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 2-[3-(2-chlorospiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane]-4-yl)oxypropoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOCCCOc1cc(Cl)nc2c1CCOC21CCOC1 |
| InChI | InChI=1S/C18H27ClN2O4/c1-21(2)6-11-22-7-3-8-24-15-12-16(19)20-17-14(15)4-9-25-18(17)5-10-23-13-18/h12H,3-11,13H2,1-2H3 |
| InChIKey | SSHWNQJHMNNQAE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|