C16H20ClNO3 — CID 168876932
2-chloro-4-(oxetan-3-ylmethoxy)spiro[6,7-dihydro-5H-quinoline-8,3'-oxolane] (PubChem CID 168876932) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 2-chloro-4-(oxetan-3-ylmethoxy)spiro[6,7-dihydro-5H-quinoline-8,3'-oxolane].
| Compound Name | 2-chloro-4-(oxetan-3-ylmethoxy)spiro[6,7-dihydro-5H-quinoline-8,3'-oxolane] |
|---|---|
| PubChem CID | 168876932 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-chloro-4-(oxetan-3-ylmethoxy)spiro[6,7-dihydro-5H-quinoline-8,3'-oxolane] |
| SMILES | Clc1cc(OCC2COC2)c2c(n1)C1(CCC2)CCOC1 |
| InChI | InChI=1S/C16H20ClNO3/c17-14-6-13(21-9-11-7-20-8-11)12-2-1-3-16(15(12)18-14)4-5-19-10-16/h6,11H,1-5,7-10H2 |
| InChIKey | KZDFJBPXDKNTLG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|