About 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole
4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole (PubChem CID 115074368) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole |
| PubChem CID | 115074368 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(c(OCC3COC3)c1)CCN2 |
| InChI | InChI=1S/C12H15NO2/c1-2-11-10(4-5-13-11)12(3-1)15-8-9-6-14-7-9/h1-3,9,13H,4-8H2 |
| InChIKey | XMINHRRFZKXYCC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole?
The IUPAC name of 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole (CID 115074368) is 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole.
What is the SMILES notation for 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole?
The canonical SMILES for 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole is c1cc2c(c(OCC3COC3)c1)CCN2.
What is the InChIKey of 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole?
The InChIKey is XMINHRRFZKXYCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-2-11-10(4-5-13-11)12(3-1)15-8-9-6-14-7-9/h1-3,9,13H,4-8H2.
What are the key properties of 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole?
4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole has a molecular weight of 205.26 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole is sourced from PubChem (CID 115074368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).