C12H15NO2 — CID 115074550
5-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole (PubChem CID 115074550) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole.
| Compound Name | 5-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115074550 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 5-(oxetan-3-ylmethoxy)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(cc1OCC1COC1)CCN2 |
| InChI | InChI=1S/C12H15NO2/c1-2-12-10(3-4-13-12)5-11(1)15-8-9-6-14-7-9/h1-2,5,9,13H,3-4,6-8H2 |
| InChIKey | TVKZXXXBDNVZMG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|