C13H18N2O — CID 115074528
5-(pyrrolidin-2-ylmethoxy)-2,3-dihydro-1H-indole (PubChem CID 115074528) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-(pyrrolidin-2-ylmethoxy)-2,3-dihydro-1H-indole.
| Compound Name | 5-(pyrrolidin-2-ylmethoxy)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115074528 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 5-(pyrrolidin-2-ylmethoxy)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(cc1OCC1CCCN1)CCN2 |
| InChI | InChI=1S/C13H18N2O/c1-2-11(14-6-1)9-16-12-3-4-13-10(8-12)5-7-15-13/h3-4,8,11,14-15H,1-2,5-7,9H2 |
| InChIKey | FAFASORMUJOHQS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|