C16H23NO — CID 115074576
5-[(4-methylcyclohexyl)methoxy]-2,3-dihydro-1H-indole (PubChem CID 115074576) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 5-[(4-methylcyclohexyl)methoxy]-2,3-dihydro-1H-indole.
| Compound Name | 5-[(4-methylcyclohexyl)methoxy]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115074576 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 5-[(4-methylcyclohexyl)methoxy]-2,3-dihydro-1H-indole |
| SMILES | CC1CCC(COc2ccc3c(c2)CCN3)CC1 |
| InChI | InChI=1S/C16H23NO/c1-12-2-4-13(5-3-12)11-18-15-6-7-16-14(10-15)8-9-17-16/h6-7,10,12-13,17H,2-5,8-9,11H2,1H3 |
| InChIKey | DOQXNJVJFFIFQR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|