C14H19NO2 — CID 115074354
4-(oxan-2-ylmethoxy)-2,3-dihydro-1H-indole (PubChem CID 115074354) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-(oxan-2-ylmethoxy)-2,3-dihydro-1H-indole.
| Compound Name | 4-(oxan-2-ylmethoxy)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115074354 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 4-(oxan-2-ylmethoxy)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(c(OCC3CCCCO3)c1)CCN2 |
| InChI | InChI=1S/C14H19NO2/c1-2-9-16-11(4-1)10-17-14-6-3-5-13-12(14)7-8-15-13/h3,5-6,11,15H,1-2,4,7-10H2 |
| InChIKey | AWOMZFGFJKGQSJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |