C13H17NOS — CID 115074331
4-(thian-4-yloxy)-2,3-dihydro-1H-indole (PubChem CID 115074331) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 4-(thian-4-yloxy)-2,3-dihydro-1H-indole.
| Compound Name | 4-(thian-4-yloxy)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115074331 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-(thian-4-yloxy)-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(c(OC3CCSCC3)c1)CCN2 |
| InChI | InChI=1S/C13H17NOS/c1-2-12-11(4-7-14-12)13(3-1)15-10-5-8-16-9-6-10/h1-3,10,14H,4-9H2 |
| InChIKey | HWDQWTAXOBQYEW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |