C17H14Cl2N4O2 — CID 166540295
6-chloro-N-[3-chloro-4-(oxetan-3-ylmethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 166540295) has the molecular formula C17H14Cl2N4O2 and a molecular weight of 377.23 g/mol. Its IUPAC name is 6-chloro-N-[3-chloro-4-(oxetan-3-ylmethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[3-chloro-4-(oxetan-3-ylmethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166540295 |
| Molecular Formula | C17H14Cl2N4O2 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 6-chloro-N-[3-chloro-4-(oxetan-3-ylmethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Clc1ccc2ncnc(Nc3ccc(OCC4COC4)c(Cl)c3)c2n1 |
| InChI | InChI=1S/C17H14Cl2N4O2/c18-12-5-11(1-3-14(12)25-8-10-6-24-7-10)22-17-16-13(20-9-21-17)2-4-15(19)23-16/h1-5,9-10H,6-8H2,(H,20,21,22) |
| InChIKey | KGWIPXPBJBRBJB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|