C18H15Cl2FN4O2 — CID 166539594
6-chloro-N-[3-chloro-2-fluoro-4-(oxolan-3-ylmethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 166539594) has the molecular formula C18H15Cl2FN4O2 and a molecular weight of 409.25 g/mol. Its IUPAC name is 6-chloro-N-[3-chloro-2-fluoro-4-(oxolan-3-ylmethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[3-chloro-2-fluoro-4-(oxolan-3-ylmethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166539594 |
| Molecular Formula | C18H15Cl2FN4O2 |
| Molecular Weight | 409.25 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 6-chloro-N-[3-chloro-2-fluoro-4-(oxolan-3-ylmethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Fc1c(Nc2ncnc3ccc(Cl)nc23)ccc(OCC2CCOC2)c1Cl |
| InChI | InChI=1S/C18H15Cl2FN4O2/c19-14-4-2-12-17(25-14)18(23-9-22-12)24-11-1-3-13(15(20)16(11)21)27-8-10-5-6-26-7-10/h1-4,9-10H,5-8H2,(H,22,23,24) |
| InChIKey | LZRMHJUAKNPWEG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.25 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|