C17H13Cl2FN4O2 — CID 166540318
6-chloro-N-[3-chloro-2-fluoro-4-(oxetan-3-ylmethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 166540318) has the molecular formula C17H13Cl2FN4O2 and a molecular weight of 395.22 g/mol. Its IUPAC name is 6-chloro-N-[3-chloro-2-fluoro-4-(oxetan-3-ylmethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[3-chloro-2-fluoro-4-(oxetan-3-ylmethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166540318 |
| Molecular Formula | C17H13Cl2FN4O2 |
| Molecular Weight | 395.22 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 6-chloro-N-[3-chloro-2-fluoro-4-(oxetan-3-ylmethoxy)phenyl]pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Fc1c(Nc2ncnc3ccc(Cl)nc23)ccc(OCC2COC2)c1Cl |
| InChI | InChI=1S/C17H13Cl2FN4O2/c18-13-4-2-11-16(24-13)17(22-8-21-11)23-10-1-3-12(14(19)15(10)20)26-7-9-5-25-6-9/h1-4,8-9H,5-7H2,(H,21,22,23) |
| InChIKey | FETBFZWGMYHONG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.22 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|