C14H7ClFN5 — CID 166540002
3-[(6-chloropyrido[3,2-d]pyrimidin-4-yl)amino]-2-fluorobenzonitrile (PubChem CID 166540002) has the molecular formula C14H7ClFN5 and a molecular weight of 299.70 g/mol. Its IUPAC name is 3-[(6-chloropyrido[3,2-d]pyrimidin-4-yl)amino]-2-fluorobenzonitrile.
| Compound Name | 3-[(6-chloropyrido[3,2-d]pyrimidin-4-yl)amino]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 166540002 |
| Molecular Formula | C14H7ClFN5 |
| Molecular Weight | 299.70 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-[(6-chloropyrido[3,2-d]pyrimidin-4-yl)amino]-2-fluorobenzonitrile |
| SMILES | N#Cc1cccc(Nc2ncnc3ccc(Cl)nc23)c1F |
| InChI | InChI=1S/C14H7ClFN5/c15-11-5-4-10-13(21-11)14(19-7-18-10)20-9-3-1-2-8(6-17)12(9)16/h1-5,7H,(H,18,19,20) |
| InChIKey | WJPDEMLSZOKGJS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.70 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|