C13H7ClF3N5 — CID 166539934
6-chloro-N-[5-(trifluoromethyl)-3-pyridinyl]pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 166539934) has the molecular formula C13H7ClF3N5 and a molecular weight of 325.68 g/mol. Its IUPAC name is 6-chloro-N-[5-(trifluoromethyl)-3-pyridinyl]pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[5-(trifluoromethyl)-3-pyridinyl]pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 166539934 |
| Molecular Formula | C13H7ClF3N5 |
| Molecular Weight | 325.68 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 6-chloro-N-[5-(trifluoromethyl)-3-pyridinyl]pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cncc(Nc2ncnc3ccc(Cl)nc23)c1 |
| InChI | InChI=1S/C13H7ClF3N5/c14-10-2-1-9-11(22-10)12(20-6-19-9)21-8-3-7(4-18-5-8)13(15,16)17/h1-6H,(H,19,20,21) |
| InChIKey | FMIYZHFRAHAFQG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.68 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|