C11H8ClN5 — CID 154196913
6-chloro-N-(1H-pyrrol-3-yl)pyrido[3,2-d]pyrimidin-4-amine (PubChem CID 154196913) has the molecular formula C11H8ClN5 and a molecular weight of 245.67 g/mol. Its IUPAC name is 6-chloro-N-(1H-pyrrol-3-yl)pyrido[3,2-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-(1H-pyrrol-3-yl)pyrido[3,2-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 154196913 |
| Molecular Formula | C11H8ClN5 |
| Molecular Weight | 245.67 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 6-chloro-N-(1H-pyrrol-3-yl)pyrido[3,2-d]pyrimidin-4-amine |
| SMILES | Clc1ccc2ncnc(Nc3cc[nH]c3)c2n1 |
| InChI | InChI=1S/C11H8ClN5/c12-9-2-1-8-10(17-9)11(15-6-14-8)16-7-3-4-13-5-7/h1-6,13H,(H,14,15,16) |
| InChIKey | QOURTRXHTOZBEG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.67 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|