C21H24ClFN6O2 — CID 166540013
tert-butyl N-[3-[[4-(3-chloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]amino]propyl]carbamate (PubChem CID 166540013) has the molecular formula C21H24ClFN6O2 and a molecular weight of 446.91 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-(3-chloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-(3-chloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 166540013 |
| Molecular Formula | C21H24ClFN6O2 |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | tert-butyl N-[3-[[4-(3-chloro-2-fluoroanilino)pyrido[3,2-d]pyrimidin-6-yl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ccc2ncnc(Nc3cccc(Cl)c3F)c2n1 |
| InChI | InChI=1S/C21H24ClFN6O2/c1-21(2,3)31-20(30)25-11-5-10-24-16-9-8-15-18(29-16)19(27-12-26-15)28-14-7-4-6-13(22)17(14)23/h4,6-9,12H,5,10-11H2,1-3H3,(H,24,29)(H,25,30)(H,26,27,28) |
| InChIKey | GOQAVHNXRZSUPA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|