C19H17BrClN3O2 — CID 166539469
6-bromo-N-[3-chloro-4-(oxolan-3-ylmethoxy)phenyl]quinazolin-4-amine (PubChem CID 166539469) has the molecular formula C19H17BrClN3O2 and a molecular weight of 434.72 g/mol. Its IUPAC name is 6-bromo-N-[3-chloro-4-(oxolan-3-ylmethoxy)phenyl]quinazolin-4-amine.
| Compound Name | 6-bromo-N-[3-chloro-4-(oxolan-3-ylmethoxy)phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 166539469 |
| Molecular Formula | C19H17BrClN3O2 |
| Molecular Weight | 434.72 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | 6-bromo-N-[3-chloro-4-(oxolan-3-ylmethoxy)phenyl]quinazolin-4-amine |
| SMILES | Clc1cc(Nc2ncnc3ccc(Br)cc23)ccc1OCC1CCOC1 |
| InChI | InChI=1S/C19H17BrClN3O2/c20-13-1-3-17-15(7-13)19(23-11-22-17)24-14-2-4-18(16(21)8-14)26-10-12-5-6-25-9-12/h1-4,7-8,11-12H,5-6,9-10H2,(H,22,23,24) |
| InChIKey | QPZDSMIPWRXXOR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.72 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |