C19H15ClN4O2 — CID 67600221
4-N-[3-chloro-4-(furan-3-ylmethoxy)phenyl]quinazoline-4,6-diamine (PubChem CID 67600221) has the molecular formula C19H15ClN4O2 and a molecular weight of 366.81 g/mol. Its IUPAC name is 4-N-[3-chloro-4-(furan-3-ylmethoxy)phenyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-[3-chloro-4-(furan-3-ylmethoxy)phenyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 67600221 |
| Molecular Formula | C19H15ClN4O2 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 4-N-[3-chloro-4-(furan-3-ylmethoxy)phenyl]quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(Nc3ccc(OCc4ccoc4)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C19H15ClN4O2/c20-16-8-14(2-4-18(16)26-10-12-5-6-25-9-12)24-19-15-7-13(21)1-3-17(15)22-11-23-19/h1-9,11H,10,21H2,(H,22,23,24) |
| InChIKey | ZQYNGYJPCUCAOK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|