C14H18BrNO4 — CID 163377534
2-bromo-6-[(3S)-3-methoxyoxolan-3-yl]-4-(oxetan-3-ylmethoxy)pyridine (PubChem CID 163377534) has the molecular formula C14H18BrNO4 and a molecular weight of 344.21 g/mol. Its IUPAC name is 2-bromo-6-[(3S)-3-methoxyoxolan-3-yl]-4-(oxetan-3-ylmethoxy)pyridine.
| Compound Name | 2-bromo-6-[(3S)-3-methoxyoxolan-3-yl]-4-(oxetan-3-ylmethoxy)pyridine |
|---|---|
| PubChem CID | 163377534 |
| Molecular Formula | C14H18BrNO4 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-bromo-6-[(3S)-3-methoxyoxolan-3-yl]-4-(oxetan-3-ylmethoxy)pyridine |
| SMILES | CO[C@]1(c2cc(OCC3COC3)cc(Br)n2)CCOC1 |
| InChI | InChI=1S/C14H18BrNO4/c1-17-14(2-3-18-9-14)12-4-11(5-13(15)16-12)20-8-10-6-19-7-10/h4-5,10H,2-3,6-9H2,1H3/t14-/m1/s1 |
| InChIKey | RLHAKBUEIWXRES-CQSZACIVSA-N |
| XLogP | 2.13 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|