C14H18ClNO4 — CID 170351467
3-[[2-chloro-6-[(3S)-3-methoxyoxolan-3-yl]-4-pyridinyl]oxy]cyclobutan-1-ol (PubChem CID 170351467) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is 3-[[2-chloro-6-[(3S)-3-methoxyoxolan-3-yl]-4-pyridinyl]oxy]cyclobutan-1-ol.
| Compound Name | 3-[[2-chloro-6-[(3S)-3-methoxyoxolan-3-yl]-4-pyridinyl]oxy]cyclobutan-1-ol |
|---|---|
| PubChem CID | 170351467 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-[[2-chloro-6-[(3S)-3-methoxyoxolan-3-yl]-4-pyridinyl]oxy]cyclobutan-1-ol |
| SMILES | CO[C@]1(c2cc(OC3CC(O)C3)cc(Cl)n2)CCOC1 |
| InChI | InChI=1S/C14H18ClNO4/c1-18-14(2-3-19-8-14)12-6-11(7-13(15)16-12)20-10-4-9(17)5-10/h6-7,9-10,17H,2-5,8H2,1H3/t9?,10?,14-/m1/s1 |
| InChIKey | UVWRIIBOYXBISK-RPFQZYLTSA-N |
| XLogP | 1.90 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|