C16H19ClN4O2 — CID 167040265
6-chloro-4-N-[6-(3-methoxyoxolan-3-yl)-4-methyl-2-pyridinyl]pyridine-3,4-diamine (PubChem CID 167040265) has the molecular formula C16H19ClN4O2 and a molecular weight of 334.81 g/mol. Its IUPAC name is 6-chloro-4-N-[6-(3-methoxyoxolan-3-yl)-4-methyl-2-pyridinyl]pyridine-3,4-diamine.
| Compound Name | 6-chloro-4-N-[6-(3-methoxyoxolan-3-yl)-4-methyl-2-pyridinyl]pyridine-3,4-diamine |
|---|---|
| PubChem CID | 167040265 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 6-chloro-4-N-[6-(3-methoxyoxolan-3-yl)-4-methyl-2-pyridinyl]pyridine-3,4-diamine |
| SMILES | COC1(c2cc(C)cc(Nc3cc(Cl)ncc3N)n2)CCOC1 |
| InChI | InChI=1S/C16H19ClN4O2/c1-10-5-13(16(22-2)3-4-23-9-16)21-15(6-10)20-12-7-14(17)19-8-11(12)18/h5-8H,3-4,9,18H2,1-2H3,(H,19,20,21) |
| InChIKey | VSTONDNGRKCCRC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|