C20H24ClN3 — CID 167080766
N-(2-chloro-5-ethenyl-4-pyridinyl)-6-(1-ethylcyclopentyl)-4-methylpyridin-2-amine (PubChem CID 167080766) has the molecular formula C20H24ClN3 and a molecular weight of 341.89 g/mol. Its IUPAC name is N-(2-chloro-5-ethenyl-4-pyridinyl)-6-(1-ethylcyclopentyl)-4-methylpyridin-2-amine.
| Compound Name | N-(2-chloro-5-ethenyl-4-pyridinyl)-6-(1-ethylcyclopentyl)-4-methylpyridin-2-amine |
|---|---|
| PubChem CID | 167080766 |
| Molecular Formula | C20H24ClN3 |
| Molecular Weight | 341.89 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-(2-chloro-5-ethenyl-4-pyridinyl)-6-(1-ethylcyclopentyl)-4-methylpyridin-2-amine |
| SMILES | C=Cc1cnc(Cl)cc1Nc1cc(C)cc(C2(CC)CCCC2)n1 |
| InChI | InChI=1S/C20H24ClN3/c1-4-15-13-22-18(21)12-16(15)23-19-11-14(3)10-17(24-19)20(5-2)8-6-7-9-20/h4,10-13H,1,5-9H2,2-3H3,(H,22,23,24) |
| InChIKey | YIWPKKYOFGFEHV-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.89 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|