C22H27Cl2N5 — CID 5330145
3-(2,6-dichlorophenyl)-7-N-[4-(diethylamino)butyl]-1,6-naphthyridine-2,7-diamine (PubChem CID 5330145) has the molecular formula C22H27Cl2N5 and a molecular weight of 432.40 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-N-[4-(diethylamino)butyl]-1,6-naphthyridine-2,7-diamine.
| Compound Name | 3-(2,6-dichlorophenyl)-7-N-[4-(diethylamino)butyl]-1,6-naphthyridine-2,7-diamine |
|---|---|
| PubChem CID | 5330145 |
| Molecular Formula | C22H27Cl2N5 |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-N-[4-(diethylamino)butyl]-1,6-naphthyridine-2,7-diamine |
| SMILES | CCN(CC)CCCCNc1cc2nc(N)c(-c3c(Cl)cccc3Cl)cc2cn1 |
| InChI | InChI=1S/C22H27Cl2N5/c1-3-29(4-2)11-6-5-10-26-20-13-19-15(14-27-20)12-16(22(25)28-19)21-17(23)8-7-9-18(21)24/h7-9,12-14H,3-6,10-11H2,1-2H3,(H2,25,28)(H,26,27) |
| InChIKey | HNGPDEJIWHVMBL-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|