C24H28Cl2N4 — CID 143313630
N-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-N',N'-diethylbutane-1,4-diamine (PubChem CID 143313630) has the molecular formula C24H28Cl2N4 and a molecular weight of 443.42 g/mol. Its IUPAC name is N-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-N',N'-diethylbutane-1,4-diamine.
| Compound Name | N-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-N',N'-diethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 143313630 |
| Molecular Formula | C24H28Cl2N4 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | N-[5,6-bis(4-chlorophenyl)pyrazin-2-yl]-N',N'-diethylbutane-1,4-diamine |
| SMILES | CCN(CC)CCCCNc1cnc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C24H28Cl2N4/c1-3-30(4-2)16-6-5-15-27-22-17-28-23(18-7-11-20(25)12-8-18)24(29-22)19-9-13-21(26)14-10-19/h7-14,17H,3-6,15-16H2,1-2H3,(H,27,29) |
| InChIKey | DHWBVXYOUYKLPX-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|