C23H24Cl2N4 — CID 143313007
5,6-bis(4-chlorophenyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]pyrazin-2-amine (PubChem CID 143313007) has the molecular formula C23H24Cl2N4 and a molecular weight of 427.38 g/mol. Its IUPAC name is 5,6-bis(4-chlorophenyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]pyrazin-2-amine.
| Compound Name | 5,6-bis(4-chlorophenyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 143313007 |
| Molecular Formula | C23H24Cl2N4 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 5,6-bis(4-chlorophenyl)-N-[(1-ethylpyrrolidin-2-yl)methyl]pyrazin-2-amine |
| SMILES | CCN1CCCC1CNc1cnc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C23H24Cl2N4/c1-2-29-13-3-4-20(29)14-26-21-15-27-22(16-5-9-18(24)10-6-16)23(28-21)17-7-11-19(25)12-8-17/h5-12,15,20H,2-4,13-14H2,1H3,(H,26,28) |
| InChIKey | ALZIMEYTDLGAIW-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |