C13H18F3N3 — CID 28819878
N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 28819878) has the molecular formula C13H18F3N3 and a molecular weight of 273.30 g/mol. Its IUPAC name is N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 28819878 |
| Molecular Formula | C13H18F3N3 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCN1CCC[C@H]1CNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C13H18F3N3/c1-2-19-7-3-4-11(19)9-18-12-6-5-10(8-17-12)13(14,15)16/h5-6,8,11H,2-4,7,9H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | RJDOUSYOOIZENO-NSHDSACASA-N |
| XLogP | 3.00 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |